CAS 1447714-17-1 appears in our catalog under these names: (S)-2-Amino-2-cycloheptylacetic acid, 97%, (2S)-2-Amino-2-cycloheptylacetic Acid, (2S)–2–Amino–2–cycloheptylacetic acid, (2S)‐2‐amino‐2‐cycloheptylacetic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-2-amino-2-cycloheptylacetic acid (CAS 1447714-17-1) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: (2S)-2-amino-2-cycloheptylacetic acid. InChIKey: GMLQOIMQMLOTNY-QMMMGPOBSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (2S)-2-amino-2-cycloheptylacetic acid |
| InChIKey | GMLQOIMQMLOTNY-QMMMGPOBSA-N |
| SMILES | C1CCCC(CC1)[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)