CAS 1690142-32-5 appears in our catalog under these names: (2R)-2-Amino-2-cycloheptyl-acetic acid, 95%, (R)-2-Amino-2-cycloheptylacetic acid, 97%, (2R)–2–Amino–2–cycloheptylacetic acid, (R)-2-Amino-2-cycloheptylacetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
(2R)-2-amino-2-cycloheptylacetic acid (CAS 1690142-32-5) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: (2R)-2-amino-2-cycloheptylacetic acid. InChIKey: GMLQOIMQMLOTNY-MRVPVSSYSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (2R)-2-amino-2-cycloheptylacetic acid |
| InChIKey | GMLQOIMQMLOTNY-MRVPVSSYSA-N |
| SMILES | C1CCCC(CC1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)