(S)-Hexahydroimidazo[1,5-a]pyrazin-3(2H)-one hydrochloride, 97%
cas: 2306252-73-1 — see every product listed under this CAS number, including other names
(S)-Hexahydroimidazo[1,5-a]pyrazin-3(2H)-one hydrochloride, 97% (CAS 2306252-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A617097-100mg |
| cas | 2306252-73-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1605.25 Pln | |
| Ambeed | 250mg | 2523.06 Pln | |
| Ambeed | 1g | 6188.75 Pln | |
| Ambeed | 5g | 18415.12 Pln | |
| Chemat | 100mg | 1226.00 Pln | |
| Chemat | 250mg | 1922.00 Pln | |
| Chemat | 1g | 4701.20 Pln | |
| BLDpharm | 100mg | 1724.97 Pln | |
| BLDpharm | 250mg | 2719.07 Pln | |
| BLDpharm | 1g | 6667.68 Pln | |
| BLDpharm | 5g | 19851.92 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
(8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride (CAS 2306252-73-1) is a chemical compound with the molecular formula C6H12ClN3O and a molecular weight of 177.63 g/mol. IUPAC name: (8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride. InChIKey: UUHJQPYNZIAAOQ-JEDNCBNOSA-N.
| Molecular formula | C6H12ClN3O |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride |
| InChIKey | UUHJQPYNZIAAOQ-JEDNCBNOSA-N |
| SMILES | C1CN2[C@@H](CN1)CNC2=O.Cl |
Computed by PubChem (NCBI)