Products 2306252-73-1
CAS 2306252-73-1 is the registry number for (S)-Hexahydroimidazo[1,5-a]pyrazin-3(2H)-one hydrochloride, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
(8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride (CAS 2306252-73-1) is a chemical compound with the molecular formula C6H12ClN3O and a molecular weight of 177.63 g/mol. IUPAC name: (8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride. InChIKey: UUHJQPYNZIAAOQ-JEDNCBNOSA-N.
| Molecular formula | C6H12ClN3O |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | (8aS)-2,5,6,7,8,8a-hexahydro-1H-imidazo[1,5-a]pyrazin-3-one;hydrochloride |
| InChIKey | UUHJQPYNZIAAOQ-JEDNCBNOSA-N |
| SMILES | C1CN2[C@@H](CN1)CNC2=O.Cl |
Computed by PubChem (NCBI)