cas: 2483-48-9 — see every product listed under this CAS number, including other names
(S)-Methyl 2,6-bis((tert-butoxycarbonyl)amino)hexanoate 95% (CAS 2483-48-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A843648-5g |
| cas | 2483-48-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1171.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A843648 |
Methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 2483-48-9) is a chemical compound with the molecular formula C17H32N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: WLPJOHSPBBUIQG-LBPRGKRZSA-N.
| Molecular formula | C17H32N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | methyl (2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| InChIKey | WLPJOHSPBBUIQG-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)