cas: 13673-95-5 — see every product listed under this CAS number, including other names
(S)-Methyl 2-hydroxy-3-phenylpropanoate, 95% (CAS 13673-95-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209838-1G |
| cas | 13673-95-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 643.54 Pln | |
| Fluorochem | 500g | 2939.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-2-hydroxy-3-phenylpropanoate (CAS 13673-95-5) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl (2S)-2-hydroxy-3-phenylpropanoate. InChIKey: NMPPJJIBQQCOOI-VIFPVBQESA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl (2S)-2-hydroxy-3-phenylpropanoate |
| InChIKey | NMPPJJIBQQCOOI-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)O |
Computed by PubChem (NCBI)