cas: 13673-95-5 — see every product listed under this CAS number, including other names
Methyl-(2S)-2-hydroxy-3-phenylpropanoate, 98%, 98% (CAS 13673-95-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149AQ-1g |
| cas | 13673-95-5 |
| size | 1g |
| availability | 974g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 227.60 Pln | |
| Chemat | 100g | 390.80 Pln | |
| Chemat | 250g | 885.20 Pln | |
| Chemat | 500g | 1771.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-hydroxy-3-phenylpropanoate (CAS 13673-95-5) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl (2S)-2-hydroxy-3-phenylpropanoate. InChIKey: NMPPJJIBQQCOOI-VIFPVBQESA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl (2S)-2-hydroxy-3-phenylpropanoate |
| InChIKey | NMPPJJIBQQCOOI-VIFPVBQESA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)O |
Computed by PubChem (NCBI)