cas: 946088-68-2 — see every product listed under this CAS number, including other names
(S)-N-CBZ-2-METHYL-AZIRIDINE, 95% (CAS 946088-68-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F304677-1G |
| cas | 946088-68-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 5g | 5350.22 Pln | |
| Fluorochem | 250mg | 674.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (2S)-2-methylaziridine-1-carboxylate (CAS 946088-68-2) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: benzyl (2S)-2-methylaziridine-1-carboxylate. InChIKey: LUBRSMFTXSITMJ-QHGLUPRGSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | benzyl (2S)-2-methylaziridine-1-carboxylate |
| InChIKey | LUBRSMFTXSITMJ-QHGLUPRGSA-N |
| SMILES | C[C@H]1CN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)