cas: 2382557-60-8 — see every product listed under this CAS number, including other names
(S)-OXETAN-3-YL(PHENYL)METHANAMINE, 97% (CAS 2382557-60-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F825270-100MG |
| cas | 2382557-60-8 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2418.96 Pln | |
| Fluorochem | 250mg | 3772.65 Pln | |
| Fluorochem | 500mg | 6245.74 Pln | |
| Fluorochem | 1g | 9135.34 Pln | |
| Fluorochem | 5g | 27269.58 Pln | |
| Chemat | 100mg | 1365.20 Pln | |
| Chemat | 250mg | 2147.60 Pln | |
| Chemat | 500mg | 3539.60 Pln | |
| Chemat | 1g | 5272.40 Pln | |
| Chemat | 5g | 15698.00 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(S)-oxetan-3-yl(phenyl)methanamine (CAS 2382557-60-8) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (S)-oxetan-3-yl(phenyl)methanamine. InChIKey: VZNUGGQHIQAFPE-SNVBAGLBSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (S)-oxetan-3-yl(phenyl)methanamine |
| InChIKey | VZNUGGQHIQAFPE-SNVBAGLBSA-N |
| SMILES | C1C(CO1)[C@@H](C2=CC=CC=C2)N |
Computed by PubChem (NCBI)