CAS 1454706-29-6 appears in our catalog under these names: (S)-S-Ethyl 2-aminopropanethioate 2,2,2-trifluoroacetate, 95%, (S)–S–Ethyl 2–aminopropanethioate 2,2,2–trifluoroacetate, (S)-S-Ethyl 2-aminopropanethioate 2,2,2-trifluoroacetate, 97%, 97%, (S)-S-Ethyl 2-aminopropanethioate 2,2,2-trifluoroacetate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
S-ethyl (2S)-2-aminopropanethioate;2,2,2-trifluoroacetic acid (CAS 1454706-29-6) is a chemical compound with the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. IUPAC name: S-ethyl (2S)-2-aminopropanethioate;2,2,2-trifluoroacetic acid. InChIKey: JDYRSJNSQIMIEN-WCCKRBBISA-N.
| Molecular formula | C7H12F3NO3S |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | S-ethyl (2S)-2-aminopropanethioate;2,2,2-trifluoroacetic acid |
| InChIKey | JDYRSJNSQIMIEN-WCCKRBBISA-N |
| SMILES | CCSC(=O)[C@H](C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)