CAS 361484-35-7 is the registry number for N-Ethyl-N-(2-(2S)-oxiranylethyl) Triflic Amide. Offered by: TRC. Available pack sizes: 1g.
N-ethyl-1,1,1-trifluoro-N-[2-[(2S)-oxiran-2-yl]ethyl]methanesulfonamide (CAS 361484-35-7) is a chemical compound with the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. IUPAC name: N-ethyl-1,1,1-trifluoro-N-[2-[(2S)-oxiran-2-yl]ethyl]methanesulfonamide. InChIKey: FZZKBQGXOHWKFF-LURJTMIESA-N.
| Molecular formula | C7H12F3NO3S |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | N-ethyl-1,1,1-trifluoro-N-[2-[(2S)-oxiran-2-yl]ethyl]methanesulfonamide |
| InChIKey | FZZKBQGXOHWKFF-LURJTMIESA-N |
| SMILES | CCN(CC[C@H]1CO1)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)