cas: 1260616-94-1 — see every product listed under this CAS number, including other names
(S)-TERT-BUTYL 2-(2-CHLOROACETYL)AZETIDINE-1-CARBOXYLATE, 98% (CAS 1260616-94-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467461-250MG |
| cas | 1260616-94-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1018.41 Pln | |
| Fluorochem | 500mg | 1981.61 Pln | |
| Fluorochem | 1g | 2913.58 Pln | |
| Fluorochem | 5g | 10619.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate (CAS 1260616-94-1) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate. InChIKey: RITDKFINXLSZFM-ZETCQYMHSA-N.
| Molecular formula | C10H16ClNO3 |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | tert-butyl (2S)-2-(2-chloroacetyl)azetidine-1-carboxylate |
| InChIKey | RITDKFINXLSZFM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)CCl |
Computed by PubChem (NCBI)