Products 1609400-65-8

CAS 1609400-65-8 is the registry number for 1-Amino-3-(3-methoxyphenoxy)-2-propanol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-amino-3-(3-methoxyphenoxy)propan-2-ol;hydrochloride (CAS 1609400-65-8) is a chemical compound with the molecular formula C10H16ClNO3 and a molecular weight of 233.69 g/mol. IUPAC name: 1-amino-3-(3-methoxyphenoxy)propan-2-ol;hydrochloride. InChIKey: IJQWXYWGHUSJCU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClNO3
Molecular weight233.69 g/mol
IUPAC name1-amino-3-(3-methoxyphenoxy)propan-2-ol;hydrochloride
InChIKeyIJQWXYWGHUSJCU-UHFFFAOYSA-N
SMILESCOC1=CC(=CC=C1)OCC(CN)O.Cl

Computed by PubChem (NCBI)