cas: 1799971-34-8 — see every product listed under this CAS number, including other names
(S)-TERT-BUTYL 2-METHYL-3-OXOPIPERAZINE-1-CARBOXYLATE, 98% (CAS 1799971-34-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530406-100MG |
| cas | 1799971-34-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 596.68 Pln | |
| Fluorochem | 1g | 1497.41 Pln | |
| Fluorochem | 5g | 5412.70 Pln | |
| Fluorochem | 10g | 10275.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (2S)-2-methyl-3-oxopiperazine-1-carboxylate (CAS 1799971-34-8) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl (2S)-2-methyl-3-oxopiperazine-1-carboxylate. InChIKey: KKVKQTLLEBWZTR-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl (2S)-2-methyl-3-oxopiperazine-1-carboxylate |
| InChIKey | KKVKQTLLEBWZTR-ZETCQYMHSA-N |
| SMILES | C[C@H]1C(=O)NCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)