Products 1349199-65-0
CAS 1349199-65-0 appears in our catalog under these names: 6-Boc-1-oxa-6-azaspiro[3.3]heptan-3-amine, 95%, 6–Boc–1–oxa–6–azaspiro(3·3)heptan–3–amine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 1mg.
Tert-butyl 3-amino-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate (CAS 1349199-65-0) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 3-amino-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate. InChIKey: QHBIPTXZAICDJO-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 3-amino-1-oxa-6-azaspiro[3.3]heptane-6-carboxylate |
| InChIKey | QHBIPTXZAICDJO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C(CO2)N |
Computed by PubChem (NCBI)