cas: 1017575-47-1 — see every product listed under this CAS number, including other names
(S)-TERT-BUTYL AZEPAN-4-YLCARBAMATE, 95% (CAS 1017575-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F505006-100MG |
| cas | 1017575-47-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 940.31 Pln | |
| Fluorochem | 250mg | 1945.17 Pln | |
| Fluorochem | 500mg | 3309.27 Pln | |
| Fluorochem | 1g | 5574.10 Pln | |
| Fluorochem | 5g | 20381.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(4S)-azepan-4-yl]carbamate (CAS 1017575-47-1) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(4S)-azepan-4-yl]carbamate. InChIKey: MIYUNZAWHSSBPU-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(4S)-azepan-4-yl]carbamate |
| InChIKey | MIYUNZAWHSSBPU-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCNCC1 |
Computed by PubChem (NCBI)