cas: 886061-26-3 — see every product listed under this CAS number, including other names
(S)-beta-(4-Chlorophenyl)alaninol, 97% (CAS 886061-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040399-100MG |
| cas | 886061-26-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 596.68 Pln | |
| Fluorochem | 10g | 1080.89 Pln | |
| Fluorochem | 25g | 2528.29 Pln | |
| Fluorochem | 100g | 9931.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-3-(4-chlorophenyl)propan-1-ol (CAS 886061-26-3) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: (3S)-3-amino-3-(4-chlorophenyl)propan-1-ol. InChIKey: JGNACDMQJLVKIU-VIFPVBQESA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-chlorophenyl)propan-1-ol |
| InChIKey | JGNACDMQJLVKIU-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1[C@H](CCO)N)Cl |
Computed by PubChem (NCBI)