CAS 1235439-82-3 appears in our catalog under these names: 1,3-Dihydro-2-benzofuran-5-ylmethanamine hydrochloride, 95%, (1,3-Dihydroisobenzofuran-5-yl)methanamine hydrochloride, 95+%, 1,3-Dihydro-2-benzofuran-5-ylmethanamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg, 2000mg, 1000mg.
1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride (CAS 1235439-82-3) is a chemical compound with the molecular formula C9H12ClNO and a molecular weight of 185.65 g/mol. IUPAC name: 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride. InChIKey: JDRYRWYXGCKYNS-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO |
|---|---|
| Molecular weight | 185.65 g/mol |
| IUPAC name | 1,3-dihydro-2-benzofuran-5-ylmethanamine;hydrochloride |
| InChIKey | JDRYRWYXGCKYNS-UHFFFAOYSA-N |
| SMILES | C1C2=C(CO1)C=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)