cas: 1334513-02-8 — see every product listed under this CAS number, including other names
(S)-isopropyl 2-(((S)-(perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate 98% (CAS 1334513-02-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A361655-5g |
| cas | 1334513-02-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1232.56 Pln | |
| Ambeed | 1000g | 2050.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A361655 |
Propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (CAS 1334513-02-8) is a chemical compound with the molecular formula C18H17F5NO5P and a molecular weight of 453.3 g/mol. IUPAC name: propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate. InChIKey: MIILDBHEJQLACD-ZJPIPACBSA-N.
| Molecular formula | C18H17F5NO5P |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| InChIKey | MIILDBHEJQLACD-ZJPIPACBSA-N |
| SMILES | C[C@@H](C(=O)OC(C)C)N[P@](=O)(OC1=CC=CC=C1)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)