cas: 1334513-02-8 — see every product listed under this CAS number, including other names
(S)-isopropyl 2-(((S)-(perfluorophenoxy)(phenoxy)phosphoryl)amino)propanoate, 99.79% (CAS 1334513-02-8) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 500 g, 50 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-59121-25 g |
| cas | 1334513-02-8 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 500 g | 1573.57 Pln | |
| MedChemExpress | 50 g | 319.69 Pln | |
| MedChemExpress | 100 g | 449.72 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.79% |
Propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate (CAS 1334513-02-8) is a chemical compound with the molecular formula C18H17F5NO5P and a molecular weight of 453.3 g/mol. IUPAC name: propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate. InChIKey: MIILDBHEJQLACD-ZJPIPACBSA-N.
| Molecular formula | C18H17F5NO5P |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | propan-2-yl (2S)-2-[[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]amino]propanoate |
| InChIKey | MIILDBHEJQLACD-ZJPIPACBSA-N |
| SMILES | C[C@@H](C(=O)OC(C)C)N[P@](=O)(OC1=CC=CC=C1)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)