cas: 148983-25-9 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (2,3-dihydroxypropyl)carbamate, 95%, 95% (CAS 148983-25-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AWKE-100mg |
| cas | 148983-25-9 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1178.00 Pln | |
| Chemat | 10g | 2018.00 Pln | |
| Chemat | 25g | 3779.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate (CAS 148983-25-9) is a chemical compound with the molecular formula C8H17NO4 and a molecular weight of 191.22 g/mol. IUPAC name: tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate. InChIKey: OWAMQHJPVUGZSB-LURJTMIESA-N.
| Molecular formula | C8H17NO4 |
|---|---|
| Molecular weight | 191.22 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2,3-dihydroxypropyl]carbamate |
| InChIKey | OWAMQHJPVUGZSB-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](CO)O |
Computed by PubChem (NCBI)