Products 1609400-89-6

CAS 1609400-89-6 is the registry number for 1-(2-Methoxyethyl)-3-pyrrolidinecarboxylic acid hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

1-(2-methoxyethyl)pyrrolidine-3-carboxylic acid;hydrate (CAS 1609400-89-6) is a chemical compound with the molecular formula C8H17NO4 and a molecular weight of 191.22 g/mol. IUPAC name: 1-(2-methoxyethyl)pyrrolidine-3-carboxylic acid;hydrate. InChIKey: MQEYILDFMOQAGW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17NO4
Molecular weight191.22 g/mol
IUPAC name1-(2-methoxyethyl)pyrrolidine-3-carboxylic acid;hydrate
InChIKeyMQEYILDFMOQAGW-UHFFFAOYSA-N
SMILESCOCCN1CCC(C1)C(=O)O.O

Computed by PubChem (NCBI)