cas: 121103-15-9 — see every product listed under this CAS number, including other names
(S)-tert-Butyl (2-aminopropyl)carbamate, 95%, 95% (CAS 121103-15-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119YCG-100mg |
| cas | 121103-15-9 |
| size | 100mg |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 923.60 Pln | |
| Chemat | 25g | 4077.20 Pln | |
| Chemat | 100g | 14334.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2S)-2-aminopropyl]carbamate (CAS 121103-15-9) is a chemical compound with the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. IUPAC name: tert-butyl N-[(2S)-2-aminopropyl]carbamate. InChIKey: UYNSYFDLTSSUNI-LURJTMIESA-N.
| Molecular formula | C8H18N2O2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-aminopropyl]carbamate |
| InChIKey | UYNSYFDLTSSUNI-LURJTMIESA-N |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)