CAS 121103-15-9 appears in our catalog under these names: (S)-tert-Butyl 2-aminopropylcarbamate, 97%, (S)–tert–Butyl (2–aminopropyl)carbamate, (S)-1-N-Boc-Propane-1,2-diamine hydrochloride, (S)-tert-Butyl (2-aminopropyl)carbamate, 95%, 95%, (S)-tert Butyl (2-aminopropyl)carbamate, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g, 100g, 500mg.
Tert-butyl N-[(2S)-2-aminopropyl]carbamate (CAS 121103-15-9) is a chemical compound with the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. IUPAC name: tert-butyl N-[(2S)-2-aminopropyl]carbamate. InChIKey: UYNSYFDLTSSUNI-LURJTMIESA-N.
| Molecular formula | C8H18N2O2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | tert-butyl N-[(2S)-2-aminopropyl]carbamate |
| InChIKey | UYNSYFDLTSSUNI-LURJTMIESA-N |
| SMILES | C[C@@H](CNC(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)