cas: 133565-49-8 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-5-thioureidopentanoate, 96%, 96% (CAS 133565-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110F2L-100mg |
| cas | 133565-49-8 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2157.20 Pln | |
| Chemat | 250mg | 4250.00 Pln | |
| Chemat | 1g | 10533.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 133565-49-8) is a chemical compound with the molecular formula C15H29N3O4S and a molecular weight of 347.5 g/mol. IUPAC name: tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: BZCHKHCGOVKYIY-JTQLQIEISA-N.
| Molecular formula | C15H29N3O4S |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | BZCHKHCGOVKYIY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCNC(=S)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)