cas: 133565-49-8 — see every product listed under this CAS number, including other names
Boc-L-Thiocitrulline-OtBu 96% (CAS 133565-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A698032-100mg |
| cas | 133565-49-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 1905.62 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A698032 |
Tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (CAS 133565-49-8) is a chemical compound with the molecular formula C15H29N3O4S and a molecular weight of 347.5 g/mol. IUPAC name: tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate. InChIKey: BZCHKHCGOVKYIY-JTQLQIEISA-N.
| Molecular formula | C15H29N3O4S |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | tert-butyl (2S)-5-(carbamothioylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| InChIKey | BZCHKHCGOVKYIY-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCNC(=S)N)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)