cas: 135065-76-8 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-(hydroxymethyl)morpholine-4-carboxylate, 97%, 97% (CAS 135065-76-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143HI-250mg |
| cas | 135065-76-8 |
| size | 250mg |
| availability | 1139g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 174.80 Pln | |
| Chemat | 50g | 270.80 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 250g | 923.60 Pln | |
| Chemat | 500g | 1646.40 Pln | |
| Chemat | 1kg | 2800.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-(hydroxymethyl)morpholine-4-carboxylate (CAS 135065-76-8) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (2S)-2-(hydroxymethyl)morpholine-4-carboxylate. InChIKey: FJYBLMJHXRWDAQ-QMMMGPOBSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (2S)-2-(hydroxymethyl)morpholine-4-carboxylate |
| InChIKey | FJYBLMJHXRWDAQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)CO |
Computed by PubChem (NCBI)