(S)-tert-Butyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97%
cas: 197358-53-5 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97% (CAS 197358-53-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A851861-1g |
| cas | 197358-53-5 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 25g | 2306.13 Pln | |
| Ambeed | 100g | 7490.38 Pln | |
| Ambeed | 500g | 31715.06 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 25g | 1902.80 Pln | |
| Chemat | 100g | 6136.40 Pln | |
| Chemat | 500g | 24427.20 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 758.65 Pln | |
| BLDpharm | 25g | 2413.62 Pln | |
| BLDpharm | 100g | 7822.83 Pln | |
| BLDpharm | 500g | 31086.86 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 197358-53-5) is a chemical compound with the molecular formula C12H25ClN2O4 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: RMMATBBIKAKDDP-QRPNPIFTSA-N.
| Molecular formula | C12H25ClN2O4 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | RMMATBBIKAKDDP-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CNC(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(S)-tert-Butyl 2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride, H-Dap(Boc)-OtBu.HCl, tert-Butyl (S)-2-Amino-3-(Boc-amino)propanoate Hydrochloride, RMMATBBIKAKDDP-QRPNPIFTSA-N, (S)-tert-Butyl 2-amino-3-(Boc-amino)propanoate HCl, tert-Butyl (2S)-amino-3-tert-butoxycarbonylaminopropionate hydrochloride, tert-butyl (S)-2-amino-3-tert-butoxycarbonylaminopropionate hydrochloride, tert-butyl (S)-2-amino-3-((tert-butoxycarbonyl)amino)propanoate hydrochloride