CAS 1333246-31-3 is the registry number for (S)-tert-Butyl 3-amino-2-((tert-butoxycarbonyl)amino)propanoate hydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride (CAS 1333246-31-3) is a chemical compound with the molecular formula C12H25ClN2O4 and a molecular weight of 296.79 g/mol. IUPAC name: tert-butyl (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride. InChIKey: NNVLQCWVLLOZNV-QRPNPIFTSA-N.
| Molecular formula | C12H25ClN2O4 |
|---|---|
| Molecular weight | 296.79 g/mol |
| IUPAC name | tert-butyl (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate;hydrochloride |
| InChIKey | NNVLQCWVLLOZNV-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CN)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)