cas: 150521-32-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-formylpiperidine-1-carboxylate 97% (CAS 150521-32-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A876269-250mg |
| cas | 150521-32-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 320.31 Pln | |
| Ambeed | 5g | 1010.06 Pln | |
| Ambeed | 25g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A876269 |
Tert-butyl (2S)-2-formylpiperidine-1-carboxylate (CAS 150521-32-7) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (2S)-2-formylpiperidine-1-carboxylate. InChIKey: KZNDGAGWQPGYTB-VIFPVBQESA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (2S)-2-formylpiperidine-1-carboxylate |
| InChIKey | KZNDGAGWQPGYTB-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C=O |
Computed by PubChem (NCBI)