cas: 1035226-84-6 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 2-methyl-1,4-diazepane-1-carboxylate, 97%, 97% (CAS 1035226-84-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GFG-50mg |
| cas | 1035226-84-6 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 323.60 Pln | |
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1029.20 Pln | |
| Chemat | 5g | 4470.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S)-2-methyl-1,4-diazepane-1-carboxylate (CAS 1035226-84-6) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (2S)-2-methyl-1,4-diazepane-1-carboxylate. InChIKey: FPUHWSHGYILARO-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (2S)-2-methyl-1,4-diazepane-1-carboxylate |
| InChIKey | FPUHWSHGYILARO-VIFPVBQESA-N |
| SMILES | C[C@H]1CNCCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)