cas: 150323-35-6 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-(tert-butylcarbamoyl)piperazine-1-carboxylate, 97%, 97% (CAS 150323-35-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MII-250mg |
| cas | 150323-35-6 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 597.20 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 10g | 1130.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-(tert-butylcarbamoyl)piperazine-1-carboxylate (CAS 150323-35-6) is a chemical compound with the molecular formula C14H27N3O3 and a molecular weight of 285.38 g/mol. IUPAC name: tert-butyl (3S)-3-(tert-butylcarbamoyl)piperazine-1-carboxylate. InChIKey: NASIOHFAYPRIAC-JTQLQIEISA-N.
| Molecular formula | C14H27N3O3 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | tert-butyl (3S)-3-(tert-butylcarbamoyl)piperazine-1-carboxylate |
| InChIKey | NASIOHFAYPRIAC-JTQLQIEISA-N |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CN(CCN1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)