CAS 2089454-69-1 appears in our catalog under these names: Edoxaban Impurity 57 (1S,2R,5R), Edoxaban Impurity 44, N-((1S,2R,5R)-2-Amino-5-((dimethylamino)carbonyl)cyclohexyl)- 1,1-dimethylethyl Ester Carbamic Acid, Edoxaban Impurity 30. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg, 200mg.
Tert-butyl N-[(1S,2R,5R)-2-amino-5-(dimethylcarbamoyl)cyclohexyl]carbamate (CAS 2089454-69-1) is a chemical compound with the molecular formula C14H27N3O3 and a molecular weight of 285.38 g/mol. IUPAC name: tert-butyl N-[(1S,2R,5R)-2-amino-5-(dimethylcarbamoyl)cyclohexyl]carbamate. InChIKey: JCHIBKSSZNWERE-MXWKQRLJSA-N.
| Molecular formula | C14H27N3O3 |
|---|---|
| Molecular weight | 285.38 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R,5R)-2-amino-5-(dimethylcarbamoyl)cyclohexyl]carbamate |
| InChIKey | JCHIBKSSZNWERE-MXWKQRLJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](CC[C@H]1N)C(=O)N(C)C |
Computed by PubChem (NCBI)