cas: 610285-62-6 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-mercaptopiperidine-1-carboxylate, 97% (CAS 610285-62-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A622578-1g |
| cas | 610285-62-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 6820.87 Pln | |
| AmBeed | 5g | 20309.59 Pln | |
| AmBeed | 250mg | 2433.13 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (3S)-3-sulfanylpiperidine-1-carboxylate (CAS 610285-62-6) is a chemical compound with the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. IUPAC name: tert-butyl (3S)-3-sulfanylpiperidine-1-carboxylate. InChIKey: NVDQWJTWJOLALV-QMMMGPOBSA-N.
| Molecular formula | C10H19NO2S |
|---|---|
| Molecular weight | 217.33 g/mol |
| IUPAC name | tert-butyl (3S)-3-sulfanylpiperidine-1-carboxylate |
| InChIKey | NVDQWJTWJOLALV-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)S |
Computed by PubChem (NCBI)