CAS 1202761-09-8 appears in our catalog under these names: (R)-3-Mercapto-piperidine-1-carboxylic acid tert-butyl ester, 95%, (R)-tert-Butyl 3-mercaptopiperidine-1-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Tert-butyl (3R)-3-sulfanylpiperidine-1-carboxylate (CAS 1202761-09-8) is a chemical compound with the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. IUPAC name: tert-butyl (3R)-3-sulfanylpiperidine-1-carboxylate. InChIKey: NVDQWJTWJOLALV-MRVPVSSYSA-N.
| Molecular formula | C10H19NO2S |
|---|---|
| Molecular weight | 217.33 g/mol |
| IUPAC name | tert-butyl (3R)-3-sulfanylpiperidine-1-carboxylate |
| InChIKey | NVDQWJTWJOLALV-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)S |
Computed by PubChem (NCBI)