cas: 1221274-36-7 — see every product listed under this CAS number, including other names
(S)-tert-Butyl 3-phenylpiperazine-1-carboxylate, 98%, 98% (CAS 1221274-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1127TC-100mg |
| cas | 1221274-36-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 500mg | 304.40 Pln | |
| Chemat | 1g | 491.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S)-3-phenylpiperazine-1-carboxylate (CAS 1221274-36-7) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl (3S)-3-phenylpiperazine-1-carboxylate. InChIKey: HRRFJZULVYGVNJ-CYBMUJFWSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl (3S)-3-phenylpiperazine-1-carboxylate |
| InChIKey | HRRFJZULVYGVNJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)