CAS 1049677-43-1 appears in our catalog under these names: 1-Boc-6-amino-3,3-dimethyl-2,3-dihydro-indole, 95%, 1-Boc-6-Amino-3,3-Dimethyl-2,3-Dihydro-Indole, tert-Butyl 6-amino-3,3-dimethylindoline-1-carboxylate, 97%. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed. Available pack sizes: 250mg, 5g, 1g, on request, 50mg.
Tert-butyl 6-amino-3,3-dimethyl-2H-indole-1-carboxylate (CAS 1049677-43-1) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: tert-butyl 6-amino-3,3-dimethyl-2H-indole-1-carboxylate. InChIKey: WKIMZHRFTRPBGZ-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 262.35 g/mol |
| IUPAC name | tert-butyl 6-amino-3,3-dimethyl-2H-indole-1-carboxylate |
| InChIKey | WKIMZHRFTRPBGZ-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C1C=CC(=C2)N)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)