cas: 213990-48-8 — see every product listed under this CAS number, including other names
(S)-tert-Butyl azepan-3-ylcarbamate, 97% (CAS 213990-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240765-100MG |
| cas | 213990-48-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 500mg | 1096.51 Pln | |
| Fluorochem | 1g | 1825.42 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(3S)-azepan-3-yl]carbamate (CAS 213990-48-8) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(3S)-azepan-3-yl]carbamate. InChIKey: NZEPWAXJSWYEDV-VIFPVBQESA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(3S)-azepan-3-yl]carbamate |
| InChIKey | NZEPWAXJSWYEDV-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCCCNC1 |
Computed by PubChem (NCBI)