cas: 1263291-39-9 — see every product listed under this CAS number, including other names
(Z,1R,8S,9S)-Ethyl bicyclo[6.1.0]non-4-ene-9-carboxylate, 95%, 95% (CAS 1263291-39-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRHM-100mg |
| cas | 1263291-39-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 707.60 Pln | |
| Chemat | 250mg | 1226.00 Pln | |
| Chemat | 1g | 3323.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate (CAS 1263291-39-9) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate. InChIKey: BAOUWGVQCUYLAA-ACNMEMRISA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | ethyl (1S,4Z,8R)-bicyclo[6.1.0]non-4-ene-9-carboxylate |
| InChIKey | BAOUWGVQCUYLAA-ACNMEMRISA-N |
| SMILES | CCOC(=O)C1[C@H]2[C@@H]1CC/C=C\CC2 |
Computed by PubChem (NCBI)