cas: 1212816-55-1 — see every product listed under this CAS number, including other names
(r)-2-Amino-2-(2,5-dichlorophenyl)ethan-1-ol, 95% (CAS 1212816-55-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F746561-25MG |
| cas | 1212816-55-1 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 2325.24 Pln | |
| Fluorochem | 50mg | 3902.81 Pln | |
| Fluorochem | 100mg | 6594.57 Pln | |
| Fluorochem | 250mg | 11150.26 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-2-(2,5-dichlorophenyl)ethanol (CAS 1212816-55-1) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: (2R)-2-amino-2-(2,5-dichlorophenyl)ethanol. InChIKey: GTRJRSYOEJFYII-QMMMGPOBSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,5-dichlorophenyl)ethanol |
| InChIKey | GTRJRSYOEJFYII-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1Cl)[C@H](CO)N)Cl |
Computed by PubChem (NCBI)