CAS 1384265-38-6 appears in our catalog under these names: 6-chloro-2,3-dihydrobenzofuran-3-amine hcl, 6-Chloro-2,3-dihydro-benzofuran-3-ylamine hydrochloride, 95%, 6-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 98%, 6-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%, 95%. Offered by: Biosynth, Combi-blocks, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 5g, 250mg, 1g, 100mg.
6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1384265-38-6) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: FNDBVJRISNWNHM-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 6-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | FNDBVJRISNWNHM-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)Cl)N.Cl |
Computed by PubChem (NCBI)