[(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate, 97%
cas: 98516-06-4 — see every product listed under this CAS number, including other names
[(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate, 97% (CAS 98516-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUBY-100mg |
| cas | 98516-06-4 |
| size | 100mg |
| availability | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 784.40 Pln | |
| Chemat | 500mg | 1264.40 Pln | |
| Chemat | 1g | 1749.20 Pln | |
| Chemat | 5g | 6746.00 Pln | |
| Chemat | 10g | 12131.60 Pln | |
| Fluorochem | 100mg | 992.38 Pln | |
| Fluorochem | 250mg | 1455.76 Pln | |
| Fluorochem | 500mg | 2340.86 Pln | |
| Fluorochem | 1g | 3257.20 Pln | |
| Fluorochem | 5g | 12306.10 Pln | |
| Fluorochem | 10g | 22162.01 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate (CAS 98516-06-4) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: [(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate. InChIKey: ULMCYJQQTKKLOY-SFYZADRCSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | [(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate |
| InChIKey | ULMCYJQQTKKLOY-SFYZADRCSA-N |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H]1CO |
Computed by PubChem (NCBI)