Products 98516-06-4
CAS 98516-06-4 appears in our catalog under these names: [(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate, 97%, 97%, [(1R,2S)-2-(HYDROXYMETHYL)CYCLOBUTYL]METHYL ACETATE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
[(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate (CAS 98516-06-4) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: [(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate. InChIKey: ULMCYJQQTKKLOY-SFYZADRCSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | [(1R,2S)-2-(hydroxymethyl)cyclobutyl]methyl acetate |
| InChIKey | ULMCYJQQTKKLOY-SFYZADRCSA-N |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H]1CO |
Computed by PubChem (NCBI)