cas: 156311-83-0 — see every product listed under this CAS number, including other names
[(7-Azabenzotriazol-1-yl)oxy]tris(pyrrolidino)phosphonium hexafluorophosphate, 98%, 98% (CAS 156311-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OOS-1g |
| cas | 156311-83-0 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 50g | 213.20 Pln | |
| Chemat | 100g | 352.40 Pln | |
| Chemat | 250g | 750.80 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 2454.80 Pln | |
| Chemat | 5kg | 8515.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate (CAS 156311-83-0) is a chemical compound with the molecular formula C17H27F6N7OP2 and a molecular weight of 521.4 g/mol. IUPAC name: tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate. InChIKey: CBZAHNDHLWAZQC-UHFFFAOYSA-N.
| Molecular formula | C17H27F6N7OP2 |
|---|---|
| Molecular weight | 521.4 g/mol |
| IUPAC name | tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate |
| InChIKey | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)ON4C5=C(C=CC=N5)N=N4.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)