cas: 156311-83-0 — see every product listed under this CAS number, including other names
PyAOP 98% (CAS 156311-83-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A919389-1g |
| cas | 156311-83-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 987.81 Pln | |
| Ambeed | 500g | 4130.62 Pln | |
| Ambeed | 1000g | 7012.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A919389 |
Tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate (CAS 156311-83-0) is a chemical compound with the molecular formula C17H27F6N7OP2 and a molecular weight of 521.4 g/mol. IUPAC name: tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate. InChIKey: CBZAHNDHLWAZQC-UHFFFAOYSA-N.
| Molecular formula | C17H27F6N7OP2 |
|---|---|
| Molecular weight | 521.4 g/mol |
| IUPAC name | tripyrrolidin-1-yl(triazolo[4,5-b]pyridin-3-yloxy)phosphanium hexafluorophosphate |
| InChIKey | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)ON4C5=C(C=CC=N5)N=N4.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)