cas: 36852-02-5 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-3,3'-dicarbonitrile, 97%, 97% (CAS 36852-02-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BY6D-100mg |
| cas | 36852-02-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 328.40 Pln | |
| Chemat | 10g | 1883.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(3-cyanophenyl)benzonitrile (CAS 36852-02-5) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 3-(3-cyanophenyl)benzonitrile. InChIKey: CNJJNOUAWHQIHN-UHFFFAOYSA-N.
| Molecular formula | C14H8N2 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 3-(3-cyanophenyl)benzonitrile |
| InChIKey | CNJJNOUAWHQIHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC=CC(=C2)C#N)C#N |
Computed by PubChem (NCBI)