CAS 42289-51-0 is the registry number for 2,3'-Dicyanobiphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(3-cyanophenyl)benzonitrile (CAS 42289-51-0) is a chemical compound with the molecular formula C14H8N2 and a molecular weight of 204.23 g/mol. IUPAC name: 2-(3-cyanophenyl)benzonitrile. InChIKey: OLCLHKQNHIAZPI-UHFFFAOYSA-N.
| Molecular formula | C14H8N2 |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 2-(3-cyanophenyl)benzonitrile |
| InChIKey | OLCLHKQNHIAZPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)