cas: 3815-20-1 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4-carboxamide, 98%, 98% (CAS 3815-20-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KU6-100mg |
| cas | 3815-20-1 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 100g | 1053.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-phenylbenzamide (CAS 3815-20-1) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 4-phenylbenzamide. InChIKey: LUQVCHRDAGWYMG-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 4-phenylbenzamide |
| InChIKey | LUQVCHRDAGWYMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)