CAS 607-00-1 appears in our catalog under these names: N,N-Diphenylformamide, 97%, N,N–Diphenylformamide, N,N-Diphenylformamide, >98.0%(GC), N,N-DIPHENYLFORMAMIDE, 99%, N,N-Diphenylformamide, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 25g, 1g, 100g, 10g.
N,N-diphenylformamide (CAS 607-00-1) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: N,N-diphenylformamide. InChIKey: DCNUQRBLZWSGAV-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | N,N-diphenylformamide |
| InChIKey | DCNUQRBLZWSGAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)