cas: 876379-83-8 — see every product listed under this CAS number, including other names
[1,2,4]Triazolo[1,5-a]pyridine-2-carboxylic acid 98% (CAS 876379-83-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A469279-250mg |
| cas | 876379-83-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1761.00 Pln | |
| Ambeed | 5g | 8519.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A469279 |
[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 876379-83-8) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: [1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: LBKMEMRXNQXYQP-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | [1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | LBKMEMRXNQXYQP-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1)C(=O)O |
Computed by PubChem (NCBI)